C16H24N2 — CID 155058757
(4Z,6E)-4-N-butan-2-ylidene-5,6-dimethyl-2-methylidenenona-4,6,8-triene-1,4-diimine (PubChem CID 155058757) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (4Z,6E)-4-N-butan-2-ylidene-5,6-dimethyl-2-methylidenenona-4,6,8-triene-1,4-diimine.
| Compound Name | (4Z,6E)-4-N-butan-2-ylidene-5,6-dimethyl-2-methylidenenona-4,6,8-triene-1,4-diimine |
|---|---|
| PubChem CID | 155058757 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (4Z,6E)-4-N-butan-2-ylidene-5,6-dimethyl-2-methylidenenona-4,6,8-triene-1,4-diimine |
| SMILES | [H]/N=C/C(=C)CC(/N=C(\C)CC)=C(C)/C(C)=C/C=C |
| InChI | InChI=1S/C16H24N2/c1-7-9-13(4)15(6)16(10-12(3)11-17)18-14(5)8-2/h7,9,11,17H,1,3,8,10H2,2,4-6H3/b13-9+,16-15-,17-11+,18-14+ |
| InChIKey | GNCLKOIRJGSHRX-QNARZYCVSA-N |
| XLogP | 4.86 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|