C32H37N7O6 — CID 155060332
tert-butyl N-[4-[8-butyl-6-(dibenzoylamino)-2-nitropurin-9-yl]butyl]carbamate (PubChem CID 155060332) has the molecular formula C32H37N7O6 and a molecular weight of 615.69 g/mol. Its IUPAC name is tert-butyl N-[4-[8-butyl-6-(dibenzoylamino)-2-nitropurin-9-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[8-butyl-6-(dibenzoylamino)-2-nitropurin-9-yl]butyl]carbamate |
|---|---|
| PubChem CID | 155060332 |
| Molecular Formula | C32H37N7O6 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | tert-butyl N-[4-[8-butyl-6-(dibenzoylamino)-2-nitropurin-9-yl]butyl]carbamate |
| SMILES | CCCCc1nc2c(N(C(=O)c3ccccc3)C(=O)c3ccccc3)nc([N+](=O)[O-])nc2n1CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H37N7O6/c1-5-6-19-24-34-25-26(37(24)21-14-13-20-33-31(42)45-32(2,3)4)35-30(39(43)44)36-27(25)38(28(40)22-15-9-7-10-16-22)29(41)23-17-11-8-12-18-23/h7-12,15-18H,5-6,13-14,19-21H2,1-4H3,(H,33,42) |
| InChIKey | KPFGMWUZRGQCNY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|