C20H26N4O2 — CID 155064021
ethanimidoyl 6-[3-(2-methoxy-4-pyridinyl)anilino]hexanimidate (PubChem CID 155064021) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethanimidoyl 6-[3-(2-methoxy-4-pyridinyl)anilino]hexanimidate.
| Compound Name | ethanimidoyl 6-[3-(2-methoxy-4-pyridinyl)anilino]hexanimidate |
|---|---|
| PubChem CID | 155064021 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | ethanimidoyl 6-[3-(2-methoxy-4-pyridinyl)anilino]hexanimidate |
| SMILES | [H]/N=C(/CCCCCNc1cccc(-c2ccnc(OC)c2)c1)O/C(C)=N/[H] |
| InChI | InChI=1S/C20H26N4O2/c1-15(21)26-19(22)9-4-3-5-11-23-18-8-6-7-16(13-18)17-10-12-24-20(14-17)25-2/h6-8,10,12-14,21-23H,3-5,9,11H2,1-2H3/b21-15+,22-19- |
| InChIKey | WRNJYSBGLKXUAB-FKXIPDHQSA-N |
| XLogP | 4.72 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|