C21H38I2N5O5P — CID 155066176
N',N'-bis[2-[(2-iodoacetyl)amino]ethyl]-N-[5-(methylamino)-6-oxo-6-phosphanylhexyl]hexanediamide (PubChem CID 155066176) has the molecular formula C21H38I2N5O5P and a molecular weight of 725.35 g/mol. Its IUPAC name is N',N'-bis[2-[(2-iodoacetyl)amino]ethyl]-N-[5-(methylamino)-6-oxo-6-phosphanylhexyl]hexanediamide.
| Compound Name | N',N'-bis[2-[(2-iodoacetyl)amino]ethyl]-N-[5-(methylamino)-6-oxo-6-phosphanylhexyl]hexanediamide |
|---|---|
| PubChem CID | 155066176 |
| Molecular Formula | C21H38I2N5O5P |
| Molecular Weight | 725.35 g/mol |
| Exact Mass | 725.07 |
| IUPAC Name | N',N'-bis[2-[(2-iodoacetyl)amino]ethyl]-N-[5-(methylamino)-6-oxo-6-phosphanylhexyl]hexanediamide |
| SMILES | CNC(CCCCNC(=O)CCCCC(=O)N(CCNC(=O)CI)CCNC(=O)CI)C(=O)P |
| InChI | InChI=1S/C21H38I2N5O5P/c1-24-16(21(33)34)6-4-5-9-25-17(29)7-2-3-8-20(32)28(12-10-26-18(30)14-22)13-11-27-19(31)15-23/h16,24H,2-15,34H2,1H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | MDPRCMXFNUZJFI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|