C16H20N2S — CID 155070359
N,N-dimethyl-1-(4-phenylsulfanylphenyl)ethane-1,2-diamine (PubChem CID 155070359) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-phenylsulfanylphenyl)ethane-1,2-diamine.
| Compound Name | N,N-dimethyl-1-(4-phenylsulfanylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 155070359 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N,N-dimethyl-1-(4-phenylsulfanylphenyl)ethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2S/c1-18(2)16(12-17)13-8-10-15(11-9-13)19-14-6-4-3-5-7-14/h3-11,16H,12,17H2,1-2H3 |
| InChIKey | GMGSZAUJHZXKNX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |