C14H28FN3 — CID 155072621
N'-[(E)-1-fluorohex-2-en-3-yl]-N-[(3S)-pyrrolidin-3-yl]butane-1,4-diamine (PubChem CID 155072621) has the molecular formula C14H28FN3 and a molecular weight of 257.40 g/mol. Its IUPAC name is N'-[(E)-1-fluorohex-2-en-3-yl]-N-[(3S)-pyrrolidin-3-yl]butane-1,4-diamine.
| Compound Name | N'-[(E)-1-fluorohex-2-en-3-yl]-N-[(3S)-pyrrolidin-3-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 155072621 |
| Molecular Formula | C14H28FN3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | N'-[(E)-1-fluorohex-2-en-3-yl]-N-[(3S)-pyrrolidin-3-yl]butane-1,4-diamine |
| SMILES | CCC/C(=C\CF)NCCCCN[C@H]1CCNC1 |
| InChI | InChI=1S/C14H28FN3/c1-2-5-13(6-8-15)17-9-3-4-10-18-14-7-11-16-12-14/h6,14,16-18H,2-5,7-12H2,1H3/b13-6+/t14-/m0/s1 |
| InChIKey | GOKBCEFQTVVWIM-BLXFFLACSA-N |
| XLogP | 1.96 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|