C10H23N3 — CID 79742043
N',N'-dimethyl-N-pyrrolidin-3-ylbutane-1,4-diamine (PubChem CID 79742043) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is N',N'-dimethyl-N-pyrrolidin-3-ylbutane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-pyrrolidin-3-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 79742043 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N',N'-dimethyl-N-pyrrolidin-3-ylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNC1CCNC1 |
| InChI | InChI=1S/C10H23N3/c1-13(2)8-4-3-6-12-10-5-7-11-9-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | OSEZZNVEIZSTHV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|