C18H20N4O — CID 155073032
(4R)-6-[3-amino-2-(methyliminomethyl)phenyl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 155073032) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is (4R)-6-[3-amino-2-(methyliminomethyl)phenyl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[3-amino-2-(methyliminomethyl)phenyl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 155073032 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4R)-6-[3-amino-2-(methyliminomethyl)phenyl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/N=C/c1c(N)cccc1-c1cccc2c1N[C@H](C)CC(=O)N2 |
| InChI | InChI=1S/C18H20N4O/c1-11-9-17(23)22-16-8-4-6-13(18(16)21-11)12-5-3-7-15(19)14(12)10-20-2/h3-8,10-11,21H,9,19H2,1-2H3,(H,22,23)/b20-10+/t11-/m1/s1 |
| InChIKey | QPCHWQKKOMHYSR-JZOCJUILSA-N |
| XLogP | 3.13 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|