C22H18F6O4 — CID 155073667
[(E,4R)-2,5-dihydroxy-4-methyl-3-methylidene-1-[4-(trifluoromethyl)phenyl]pent-1-enyl] 4-(trifluoromethyl)benzoate (PubChem CID 155073667) has the molecular formula C22H18F6O4 and a molecular weight of 460.37 g/mol. Its IUPAC name is [(E,4R)-2,5-dihydroxy-4-methyl-3-methylidene-1-[4-(trifluoromethyl)phenyl]pent-1-enyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(E,4R)-2,5-dihydroxy-4-methyl-3-methylidene-1-[4-(trifluoromethyl)phenyl]pent-1-enyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 155073667 |
| Molecular Formula | C22H18F6O4 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [(E,4R)-2,5-dihydroxy-4-methyl-3-methylidene-1-[4-(trifluoromethyl)phenyl]pent-1-enyl] 4-(trifluoromethyl)benzoate |
| SMILES | C=C(/C(O)=C(\OC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)[C@@H](C)CO |
| InChI | InChI=1S/C22H18F6O4/c1-12(11-29)13(2)18(30)19(14-3-7-16(8-4-14)21(23,24)25)32-20(31)15-5-9-17(10-6-15)22(26,27)28/h3-10,12,29-30H,2,11H2,1H3/b19-18+/t12-/m0/s1 |
| InChIKey | YLKHHUVKWQFONO-RUWSDDDDSA-N |
| XLogP | 5.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|