C15H12N4 — CID 15507426
2,5-dipyridin-4-yl-3,4-diazabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 15507426) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2,5-dipyridin-4-yl-3,4-diazabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 2,5-dipyridin-4-yl-3,4-diazabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 15507426 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2,5-dipyridin-4-yl-3,4-diazabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | c1cc(C2=NN=C(c3ccncc3)C3CC23)ccn1 |
| InChI | InChI=1S/C15H12N4/c1-5-16-6-2-10(1)14-12-9-13(12)15(19-18-14)11-3-7-17-8-4-11/h1-8,12-13H,9H2 |
| InChIKey | QVRZFCYQONALIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |