C28H40O6 — CID 155079361
6-[(3S,4S,10S,12R,13R)-3,12-dihydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylidenehexanoic acid (PubChem CID 155079361) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is 6-[(3S,4S,10S,12R,13R)-3,12-dihydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylidenehexanoic acid.
| Compound Name | 6-[(3S,4S,10S,12R,13R)-3,12-dihydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylidenehexanoic acid |
|---|---|
| PubChem CID | 155079361 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 6-[(3S,4S,10S,12R,13R)-3,12-dihydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylidenehexanoic acid |
| SMILES | C=C(CCCC1CCC2C3=C(C(=O)[C@H](O)[C@]12C)[C@@]1(C)CC[C@H](O)[C@@H](C)C1CC3=O)C(C)C(=O)O |
| InChI | InChI=1S/C28H40O6/c1-14(15(2)26(33)34)7-6-8-17-9-10-18-22-21(30)13-19-16(3)20(29)11-12-27(19,4)23(22)24(31)25(32)28(17,18)5/h15-20,25,29,32H,1,6-13H2,2-5H3,(H,33,34)/t15?,16-,17?,18?,19?,20-,25-,27-,28+/m0/s1 |
| InChIKey | MGZNGAHPMSYBOR-AJJYURRRSA-N |
| XLogP | 4.09 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|