C24H41NO3 — CID 155085110
4-[(1S,5S,6R,11S,16S,18S)-1-amino-18-hydroxy-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butanoic acid (PubChem CID 155085110) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 4-[(1S,5S,6R,11S,16S,18S)-1-amino-18-hydroxy-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butanoic acid.
| Compound Name | 4-[(1S,5S,6R,11S,16S,18S)-1-amino-18-hydroxy-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butanoic acid |
|---|---|
| PubChem CID | 155085110 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 4-[(1S,5S,6R,11S,16S,18S)-1-amino-18-hydroxy-6,11-dimethyl-5-tetracyclo[8.8.0.02,6.011,16]octadecanyl]butanoic acid |
| SMILES | C[C@]12CCCC3[C@](N)(C1CC[C@@H]2CCCC(=O)O)[C@@H](O)C[C@@H]1CCCC[C@]31C |
| InChI | InChI=1S/C24H41NO3/c1-22-14-6-9-18-23(2)13-4-3-7-17(23)15-20(26)24(18,25)19(22)12-11-16(22)8-5-10-21(27)28/h16-20,26H,3-15,25H2,1-2H3,(H,27,28)/t16-,17-,18?,19?,20-,22+,23-,24-/m0/s1 |
| InChIKey | IREFSJQSLOXPSN-WCJOOCFHSA-N |
| XLogP | 4.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |