C21H20ClFN2O — CID 155087872
2-[(2R,3aR,6aR)-5-(3-fluoro-4-pyridinyl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 155087872) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 2-[(2R,3aR,6aR)-5-(3-fluoro-4-pyridinyl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(2R,3aR,6aR)-5-(3-fluoro-4-pyridinyl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 155087872 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[(2R,3aR,6aR)-5-(3-fluoro-4-pyridinyl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1C[C@@H]2CC(c3ccncc3F)=C[C@@H]2C1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClFN2O/c22-17-1-3-18(4-2-17)25-21(26)9-13-7-14-10-16(11-15(14)8-13)19-5-6-24-12-20(19)23/h1-6,10,12-15H,7-9,11H2,(H,25,26)/t13-,14-,15+/m0/s1 |
| InChIKey | FRIGIQUPXWDLGH-SOUVJXGZSA-N |
| XLogP | 5.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |