C18H13NO2 — CID 15509514
6-nitro-3,4-dihydrochrysene (PubChem CID 15509514) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-nitro-3,4-dihydrochrysene.
| Compound Name | 6-nitro-3,4-dihydrochrysene |
|---|---|
| PubChem CID | 15509514 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 6-nitro-3,4-dihydrochrysene |
| SMILES | O=[N+]([O-])c1cc2c3c(ccc2c2ccccc12)C=CCC3 |
| InChI | InChI=1S/C18H13NO2/c20-19(21)18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1,3-5,7-11H,2,6H2 |
| InChIKey | LLIMTJDOGGRSJZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|