benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate

C17H20N4O3 — CID 155095919

IUPACbenzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate
SMILESO=C(CN1CCN(c2ccc(=O)[nH]n2)CC1)OCc1ccccc1
InChIInChI=1S/C17H20N4O3/c22-16-7-6-15(18-19-16)21-10-8-20(9-11-21)12-17(23)24-13-14-4-2-1-3-5-14/h1-7H,8-13H2,(H,19,22)
InChIKeyUZHJWZPSSQOTTA-UHFFFAOYSA-N
MW328.37 g/mol
LogP0.64
Rot. Bonds5

About benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate

benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate (PubChem CID 155095919) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate.

Molecular Properties

Compound Namebenzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate
PubChem CID155095919
Molecular FormulaC17H20N4O3
Molecular Weight328.37 g/mol
Exact Mass328.15
IUPAC Namebenzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate
SMILESO=C(CN1CCN(c2ccc(=O)[nH]n2)CC1)OCc1ccccc1
InChIInChI=1S/C17H20N4O3/c22-16-7-6-15(18-19-16)21-10-8-20(9-11-21)12-17(23)24-13-14-4-2-1-3-5-14/h1-7H,8-13H2,(H,19,22)
InChIKeyUZHJWZPSSQOTTA-UHFFFAOYSA-N
XLogP0.64
TPSA78.53 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.37
LogP ≤ 50.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate?
The IUPAC name of benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate (CID 155095919) is benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate.
What is the SMILES notation for benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate?
The canonical SMILES for benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate is O=C(CN1CCN(c2ccc(=O)[nH]n2)CC1)OCc1ccccc1.
What is the InChIKey of benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate?
The InChIKey is UZHJWZPSSQOTTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O3/c22-16-7-6-15(18-19-16)21-10-8-20(9-11-21)12-17(23)24-13-14-4-2-1-3-5-14/h1-7H,8-13H2,(H,19,22).
What are the key properties of benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate?
benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate has a molecular weight of 328.37 g/mol, XLogP of 0.64, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[4-(6-oxo-1H-pyridazin-3-yl)piperazin-1-yl]acetate is sourced from PubChem (CID 155095919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).