C24H28N6O — CID 155096503
N-ethyl-5-methyl-N-(methylideneamino)-6-[(3R)-3-phenoxypiperidin-1-yl]-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 155096503) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is N-ethyl-5-methyl-N-(methylideneamino)-6-[(3R)-3-phenoxypiperidin-1-yl]-2-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N-ethyl-5-methyl-N-(methylideneamino)-6-[(3R)-3-phenoxypiperidin-1-yl]-2-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 155096503 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-ethyl-5-methyl-N-(methylideneamino)-6-[(3R)-3-phenoxypiperidin-1-yl]-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | C=NN(CC)c1nc(-c2cccnc2)nc(N2CCC[C@@H](Oc3ccccc3)C2)c1C |
| InChI | InChI=1S/C24H28N6O/c1-4-30(25-3)24-18(2)23(27-22(28-24)19-10-8-14-26-16-19)29-15-9-13-21(17-29)31-20-11-6-5-7-12-20/h5-8,10-12,14,16,21H,3-4,9,13,15,17H2,1-2H3/t21-/m1/s1 |
| InChIKey | FKBPHCFXDJSQCE-OAQYLSRUSA-N |
| XLogP | 4.34 |
| TPSA | 66.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|