C24H25FN6 — CID 155099348
7-[3-[[2-(4-fluorophenyl)cyclopropyl]methylamino]-1-phenylpropyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 155099348) has the molecular formula C24H25FN6 and a molecular weight of 416.50 g/mol. Its IUPAC name is 7-[3-[[2-(4-fluorophenyl)cyclopropyl]methylamino]-1-phenylpropyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[3-[[2-(4-fluorophenyl)cyclopropyl]methylamino]-1-phenylpropyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 155099348 |
| Molecular Formula | C24H25FN6 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 7-[3-[[2-(4-fluorophenyl)cyclopropyl]methylamino]-1-phenylpropyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(C(CCNCC2CC2c2ccc(F)cc2)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C24H25FN6/c25-18-8-6-16(7-9-18)20-12-17(20)14-27-11-10-19(15-4-2-1-3-5-15)21-13-22(26)28-24-23(21)29-31-30-24/h1-9,13,17,19-20,27H,10-12,14H2,(H3,26,28,29,30,31) |
| InChIKey | WTRBKPVBGPAZPD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|