C21H22N6 — CID 145371678
7-[1-phenyl-2-(2-phenylethylamino)ethyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 145371678) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 7-[1-phenyl-2-(2-phenylethylamino)ethyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[1-phenyl-2-(2-phenylethylamino)ethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 145371678 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 7-[1-phenyl-2-(2-phenylethylamino)ethyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(C(CNCCc2ccccc2)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C21H22N6/c22-19-13-17(20-21(24-19)26-27-25-20)18(16-9-5-2-6-10-16)14-23-12-11-15-7-3-1-4-8-15/h1-10,13,18,23H,11-12,14H2,(H3,22,24,25,26,27) |
| InChIKey | WYOJDVOEZMHDEC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|