C18H16N4 — CID 155099349
4-(2-phenyl-1-pyridin-2-ylethenyl)pyridine-2,6-diamine (PubChem CID 155099349) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(2-phenyl-1-pyridin-2-ylethenyl)pyridine-2,6-diamine.
| Compound Name | 4-(2-phenyl-1-pyridin-2-ylethenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 155099349 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(2-phenyl-1-pyridin-2-ylethenyl)pyridine-2,6-diamine |
| SMILES | Nc1cc(C(=Cc2ccccc2)c2ccccn2)cc(N)n1 |
| InChI | InChI=1S/C18H16N4/c19-17-11-14(12-18(20)22-17)15(16-8-4-5-9-21-16)10-13-6-2-1-3-7-13/h1-12H,(H4,19,20,22) |
| InChIKey | TYSQHJUZHGGLEW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |