C16H12ClN2O4S- — CID 155099893
4-[3-chloro-4-(sulfinatoamino)phenoxy]-7-methoxyquinoline (PubChem CID 155099893) has the molecular formula C16H12ClN2O4S- and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-[3-chloro-4-(sulfinatoamino)phenoxy]-7-methoxyquinoline.
| Compound Name | 4-[3-chloro-4-(sulfinatoamino)phenoxy]-7-methoxyquinoline |
|---|---|
| PubChem CID | 155099893 |
| Molecular Formula | C16H12ClN2O4S- |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-[3-chloro-4-(sulfinatoamino)phenoxy]-7-methoxyquinoline |
| SMILES | COc1ccc2c(Oc3ccc(NS(=O)[O-])c(Cl)c3)ccnc2c1 |
| InChI | InChI=1S/C16H13ClN2O4S/c1-22-10-2-4-12-15(9-10)18-7-6-16(12)23-11-3-5-14(13(17)8-11)19-24(20)21/h2-9,19H,1H3,(H,20,21)/p-1 |
| InChIKey | SQFYVRXIRVJDTD-UHFFFAOYSA-M |
| XLogP | 3.90 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|