C21H24F3NO8S — CID 155103962
3-[4-methoxy-5-[[6-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-benzodioxol-5-yl]methyl]furan-2-yl]propyl methanesulfonate (PubChem CID 155103962) has the molecular formula C21H24F3NO8S and a molecular weight of 507.48 g/mol. Its IUPAC name is 3-[4-methoxy-5-[[6-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-benzodioxol-5-yl]methyl]furan-2-yl]propyl methanesulfonate.
| Compound Name | 3-[4-methoxy-5-[[6-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-benzodioxol-5-yl]methyl]furan-2-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 155103962 |
| Molecular Formula | C21H24F3NO8S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 3-[4-methoxy-5-[[6-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-benzodioxol-5-yl]methyl]furan-2-yl]propyl methanesulfonate |
| SMILES | COc1cc(CCCOS(C)(=O)=O)oc1Cc1cc2c(cc1CCNC(=O)C(F)(F)F)OCO2 |
| InChI | InChI=1S/C21H24F3NO8S/c1-29-16-11-15(4-3-7-32-34(2,27)28)33-19(16)10-14-9-18-17(30-12-31-18)8-13(14)5-6-25-20(26)21(22,23)24/h8-9,11H,3-7,10,12H2,1-2H3,(H,25,26) |
| InChIKey | DEMCRDDTRJBXPX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|