C12H11F3INO4 — CID 175078994
2,2,2-trifluoro-N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]acetamide (PubChem CID 175078994) has the molecular formula C12H11F3INO4 and a molecular weight of 417.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 175078994 |
| Molecular Formula | C12H11F3INO4 |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]acetamide |
| SMILES | COc1cc(C(I)CNC(=O)C(F)(F)F)cc2c1OCO2 |
| InChI | InChI=1S/C12H11F3INO4/c1-19-8-2-6(3-9-10(8)21-5-20-9)7(16)4-17-11(18)12(13,14)15/h2-3,7H,4-5H2,1H3,(H,17,18) |
| InChIKey | MCUAHOONCIOYHB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|