C14H16INO5 — CID 175078872
prop-2-enyl N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate (PubChem CID 175078872) has the molecular formula C14H16INO5 and a molecular weight of 405.19 g/mol. Its IUPAC name is prop-2-enyl N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 175078872 |
| Molecular Formula | C14H16INO5 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | prop-2-enyl N-[2-iodo-2-(7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate |
| SMILES | C=CCOC(=O)NCC(I)c1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H16INO5/c1-3-4-19-14(17)16-7-10(15)9-5-11(18-2)13-12(6-9)20-8-21-13/h3,5-6,10H,1,4,7-8H2,2H3,(H,16,17) |
| InChIKey | YJZCHBQNMKDBIG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|