C25H27NO9 — CID 175074190
2,3-dimethoxy-6-[(E)-2-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]benzoic acid (PubChem CID 175074190) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(E)-2-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]benzoic acid.
| Compound Name | 2,3-dimethoxy-6-[(E)-2-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 175074190 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2,3-dimethoxy-6-[(E)-2-[4-methoxy-6-[2-(prop-2-enoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]benzoic acid |
| SMILES | C=CCOC(=O)NCCc1cc2c(c(OC)c1/C=C/c1ccc(OC)c(OC)c1C(=O)O)OCO2 |
| InChI | InChI=1S/C25H27NO9/c1-5-12-33-25(29)26-11-10-16-13-19-23(35-14-34-19)21(31-3)17(16)8-6-15-7-9-18(30-2)22(32-4)20(15)24(27)28/h5-9,13H,1,10-12,14H2,2-4H3,(H,26,29)(H,27,28)/b8-6+ |
| InChIKey | ROFMGYSXQVCUCE-SOFGYWHQSA-N |
| XLogP | 3.76 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|