C37H35NO10 — CID 155681620
methyl 6-[3-[6-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methoxy-1,3-benzodioxol-5-yl]oxiran-2-yl]-2,3-dimethoxybenzoate (PubChem CID 155681620) has the molecular formula C37H35NO10 and a molecular weight of 653.68 g/mol. Its IUPAC name is methyl 6-[3-[6-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methoxy-1,3-benzodioxol-5-yl]oxiran-2-yl]-2,3-dimethoxybenzoate.
| Compound Name | methyl 6-[3-[6-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methoxy-1,3-benzodioxol-5-yl]oxiran-2-yl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 155681620 |
| Molecular Formula | C37H35NO10 |
| Molecular Weight | 653.68 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | methyl 6-[3-[6-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methoxy-1,3-benzodioxol-5-yl]oxiran-2-yl]-2,3-dimethoxybenzoate |
| SMILES | COC(=O)c1c(C2OC2c2c(CCNC(=O)OCC3c4ccccc4-c4ccccc43)cc3c(c2OC)OCO3)ccc(OC)c1OC |
| InChI | InChI=1S/C37H35NO10/c1-41-27-14-13-25(30(32(27)42-2)36(39)44-4)31-35(48-31)29-20(17-28-33(34(29)43-3)47-19-46-28)15-16-38-37(40)45-18-26-23-11-7-5-9-21(23)22-10-6-8-12-24(22)26/h5-14,17,26,31,35H,15-16,18-19H2,1-4H3,(H,38,40) |
| InChIKey | HICBTWHPTSOLMK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|