C24H27NO10 — CID 155681592
methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(methoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate (PubChem CID 155681592) has the molecular formula C24H27NO10 and a molecular weight of 489.48 g/mol. Its IUPAC name is methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(methoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate.
| Compound Name | methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(methoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate |
|---|---|
| PubChem CID | 155681592 |
| Molecular Formula | C24H27NO10 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 2,3-dimethoxy-6-[3-[4-methoxy-6-[2-(methoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]oxiran-2-yl]benzoate |
| SMILES | COC(=O)NCCc1cc2c(c(OC)c1C1OC1c1ccc(OC)c(OC)c1C(=O)OC)OCO2 |
| InChI | InChI=1S/C24H27NO10/c1-28-14-7-6-13(17(19(14)29-2)23(26)31-4)18-22(35-18)16-12(8-9-25-24(27)32-5)10-15-20(21(16)30-3)34-11-33-15/h6-7,10,18,22H,8-9,11H2,1-5H3,(H,25,27) |
| InChIKey | TZKOCVCZBJWNMQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|