C24H27NO8 — CID 155681677
methyl 6-[(E)-2-[6-[2-(ethoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]-2,3-dimethoxybenzoate (PubChem CID 155681677) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is methyl 6-[(E)-2-[6-[2-(ethoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]-2,3-dimethoxybenzoate.
| Compound Name | methyl 6-[(E)-2-[6-[2-(ethoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 155681677 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | methyl 6-[(E)-2-[6-[2-(ethoxycarbonylamino)ethyl]-1,3-benzodioxol-5-yl]ethenyl]-2,3-dimethoxybenzoate |
| SMILES | CCOC(=O)NCCc1cc2c(cc1/C=C/c1ccc(OC)c(OC)c1C(=O)OC)OCO2 |
| InChI | InChI=1S/C24H27NO8/c1-5-31-24(27)25-11-10-17-13-20-19(32-14-33-20)12-16(17)7-6-15-8-9-18(28-2)22(29-3)21(15)23(26)30-4/h6-9,12-13H,5,10-11,14H2,1-4H3,(H,25,27)/b7-6+ |
| InChIKey | YNCFHRKEEKPHJB-VOTSOKGWSA-N |
| XLogP | 3.68 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|