C27H27NO5 — CID 169470816
9H-fluoren-9-ylmethyl N-[3-(2,3,4-trimethoxyphenyl)prop-2-enyl]carbamate (PubChem CID 169470816) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,3,4-trimethoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,3,4-trimethoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470816 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,3,4-trimethoxyphenyl)prop-2-enyl]carbamate |
| SMILES | COc1ccc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)c(OC)c1OC |
| InChI | InChI=1S/C27H27NO5/c1-30-24-15-14-18(25(31-2)26(24)32-3)9-8-16-28-27(29)33-17-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h4-15,23H,16-17H2,1-3H3,(H,28,29) |
| InChIKey | ALYIDQNNKLVCMA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |