C19H20INO6 — CID 155681546
(4-methoxyphenyl)methyl N-[2-(6-iodo-7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate (PubChem CID 155681546) has the molecular formula C19H20INO6 and a molecular weight of 485.27 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[2-(6-iodo-7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[2-(6-iodo-7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 155681546 |
| Molecular Formula | C19H20INO6 |
| Molecular Weight | 485.27 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[2-(6-iodo-7-methoxy-1,3-benzodioxol-5-yl)ethyl]carbamate |
| SMILES | COc1ccc(COC(=O)NCCc2cc3c(c(OC)c2I)OCO3)cc1 |
| InChI | InChI=1S/C19H20INO6/c1-23-14-5-3-12(4-6-14)10-25-19(22)21-8-7-13-9-15-17(27-11-26-15)18(24-2)16(13)20/h3-6,9H,7-8,10-11H2,1-2H3,(H,21,22) |
| InChIKey | FZWOTYYLDRFVHU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|