C19H18O7 — CID 54020077
methyl 2-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-3-oxopropanoate (PubChem CID 54020077) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 2-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-3-oxopropanoate.
| Compound Name | methyl 2-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 54020077 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 2-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)c1ccc(OC)cc1)c1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H18O7/c1-22-13-6-4-11(5-7-13)17(20)16(19(21)24-3)12-8-14(23-2)18-15(9-12)25-10-26-18/h4-9,16H,10H2,1-3H3 |
| InChIKey | KYHRIOOYOIFRTB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|