C11H24N2 — CID 155110008
2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine (PubChem CID 155110008) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine.
| Compound Name | 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine |
|---|---|
| PubChem CID | 155110008 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine |
| SMILES | C=C(C(C)C(C)N)N(C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2/c1-8(9(2)12)10(3)13(7)11(4,5)6/h8-9H,3,12H2,1-2,4-7H3 |
| InChIKey | PZROWUOJFWHUNK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |