About 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine
2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine (PubChem CID 155110008) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine |
| PubChem CID | 155110008 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine |
| SMILES | C=C(C(C)C(C)N)N(C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2/c1-8(9(2)12)10(3)13(7)11(4,5)6/h8-9H,3,12H2,1-2,4-7H3 |
| InChIKey | PZROWUOJFWHUNK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine?
The IUPAC name of 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine (CID 155110008) is 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine.
What is the SMILES notation for 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine?
The canonical SMILES for 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine is C=C(C(C)C(C)N)N(C)C(C)(C)C.
What is the InChIKey of 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine?
The InChIKey is PZROWUOJFWHUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-8(9(2)12)10(3)13(7)11(4,5)6/h8-9H,3,12H2,1-2,4-7H3.
What are the key properties of 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine?
2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine has a molecular weight of 184.33 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-tert-butyl-2-N,3-dimethylpent-1-ene-2,4-diamine is sourced from PubChem (CID 155110008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).