C11H24N2S — CID 88936298
1,3-ditert-butyl-1,3-dimethylthiourea (PubChem CID 88936298) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 1,3-ditert-butyl-1,3-dimethylthiourea.
| Compound Name | 1,3-ditert-butyl-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 88936298 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 1,3-ditert-butyl-1,3-dimethylthiourea |
| SMILES | CN(C(=S)N(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2S/c1-10(2,3)12(7)9(14)13(8)11(4,5)6/h1-8H3 |
| InChIKey | ICPNKPXDJIDIAS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|