C14H21ClN2O2S — CID 155117003
(NE,S)-N-[4-chloro-1-(2-methoxy-3-pyridinyl)butylidene]-2-methylpropane-2-sulfinamide (PubChem CID 155117003) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is (NE,S)-N-[4-chloro-1-(2-methoxy-3-pyridinyl)butylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[4-chloro-1-(2-methoxy-3-pyridinyl)butylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 155117003 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (NE,S)-N-[4-chloro-1-(2-methoxy-3-pyridinyl)butylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ncccc1/C(CCCCl)=N/[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H21ClN2O2S/c1-14(2,3)20(18)17-12(8-5-9-15)11-7-6-10-16-13(11)19-4/h6-7,10H,5,8-9H2,1-4H3/b17-12+/t20-/m0/s1 |
| InChIKey | IYBSRGUHMRSTMB-KZFLWGQDSA-N |
| XLogP | 3.36 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|