C12H18ClNOS2 — CID 75167332
N-(4-chloro-1-thiophen-2-ylbutylidene)-2-methylpropane-2-sulfinamide (PubChem CID 75167332) has the molecular formula C12H18ClNOS2 and a molecular weight of 291.87 g/mol. Its IUPAC name is N-(4-chloro-1-thiophen-2-ylbutylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | N-(4-chloro-1-thiophen-2-ylbutylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 75167332 |
| Molecular Formula | C12H18ClNOS2 |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-(4-chloro-1-thiophen-2-ylbutylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=C(CCCCl)c1cccs1 |
| InChI | InChI=1S/C12H18ClNOS2/c1-12(2,3)17(15)14-10(6-4-8-13)11-7-5-9-16-11/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | RSVRRIXJNOCZIH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|