C16H25N — CID 155119648
(3E,5E)-N-methyl-5-[(Z)-prop-1-enyl]-N-propylnona-3,5,7,8-tetraen-1-amine (PubChem CID 155119648) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (3E,5E)-N-methyl-5-[(Z)-prop-1-enyl]-N-propylnona-3,5,7,8-tetraen-1-amine.
| Compound Name | (3E,5E)-N-methyl-5-[(Z)-prop-1-enyl]-N-propylnona-3,5,7,8-tetraen-1-amine |
|---|---|
| PubChem CID | 155119648 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (3E,5E)-N-methyl-5-[(Z)-prop-1-enyl]-N-propylnona-3,5,7,8-tetraen-1-amine |
| SMILES | C=C=C/C=C(\C=C/C)/C=C/CCN(C)CCC |
| InChI | InChI=1S/C16H25N/c1-5-8-12-16(11-6-2)13-9-10-15-17(4)14-7-3/h6,8-9,11-13H,1,7,10,14-15H2,2-4H3/b11-6-,13-9+,16-12+ |
| InChIKey | NIGZRGVRGWXPDO-QLAJFWFRSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|