C15H26O5 — CID 15512036
methyl (2E,4S,6R)-6-(2,2-dimethoxyethyl)-4-hydroxy-3,7-dimethylocta-2,7-dienoate (PubChem CID 15512036) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (2E,4S,6R)-6-(2,2-dimethoxyethyl)-4-hydroxy-3,7-dimethylocta-2,7-dienoate.
| Compound Name | methyl (2E,4S,6R)-6-(2,2-dimethoxyethyl)-4-hydroxy-3,7-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 15512036 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | methyl (2E,4S,6R)-6-(2,2-dimethoxyethyl)-4-hydroxy-3,7-dimethylocta-2,7-dienoate |
| SMILES | C=C(C)[C@@H](CC(OC)OC)C[C@H](O)/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C15H26O5/c1-10(2)12(9-15(19-5)20-6)8-13(16)11(3)7-14(17)18-4/h7,12-13,15-16H,1,8-9H2,2-6H3/b11-7+/t12-,13+/m1/s1 |
| InChIKey | AQDNFRFYABOLJO-OXJBHRBVSA-N |
| XLogP | 2.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|