C13H18ClN3O4 — CID 155123944
(6S)-3-(5-chloropentanoylamino)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxylic acid (PubChem CID 155123944) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is (6S)-3-(5-chloropentanoylamino)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxylic acid.
| Compound Name | (6S)-3-(5-chloropentanoylamino)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 155123944 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (6S)-3-(5-chloropentanoylamino)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxylic acid |
| SMILES | C[C@H]1Cc2noc(NC(=O)CCCCCl)c2CN1C(=O)O |
| InChI | InChI=1S/C13H18ClN3O4/c1-8-6-10-9(7-17(8)13(19)20)12(21-16-10)15-11(18)4-2-3-5-14/h8H,2-7H2,1H3,(H,15,18)(H,19,20)/t8-/m0/s1 |
| InChIKey | SGSVMLPXDCNCGD-QMMMGPOBSA-N |
| XLogP | 2.45 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|