C32H41Cl2N3O3 — CID 155124504
(1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol;2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole (PubChem CID 155124504) has the molecular formula C32H41Cl2N3O3 and a molecular weight of 586.60 g/mol. Its IUPAC name is (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol;2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole.
| Compound Name | (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol;2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 155124504 |
| Molecular Formula | C32H41Cl2N3O3 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol;2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC(Oc1c(Cl)cccc1Cl)C1=NCCN1.Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C21H29NO2.C11H12Cl2N2O/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15;1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h6-7,13,15,19,23-24H,1-5,8-12,14H2;2-4,7H,5-6H2,1H3,(H,14,15)/t19-,20+,21-;/m1./s1 |
| InChIKey | HLHLZEUWFIENNK-SXWPHCFWSA-N |
| XLogP | 6.13 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |