C23H30O3 — CID 155131024
[2-methyl-1-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]propan-2-yl] formate (PubChem CID 155131024) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [2-methyl-1-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]propan-2-yl] formate.
| Compound Name | [2-methyl-1-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]propan-2-yl] formate |
|---|---|
| PubChem CID | 155131024 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [2-methyl-1-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]propan-2-yl] formate |
| SMILES | CC(C)(COC(C)(C)c1ccc(C(C)(C)c2ccccc2)cc1)OC=O |
| InChI | InChI=1S/C23H30O3/c1-21(2,26-17-24)16-25-23(5,6)20-14-12-19(13-15-20)22(3,4)18-10-8-7-9-11-18/h7-15,17H,16H2,1-6H3 |
| InChIKey | AYUONSGHYXCUEY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|