C27H27N3O3S — CID 155132468
[4-[2-(3-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylphenyl] 2-methylprop-2-enoate (PubChem CID 155132468) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is [4-[2-(3-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-(3-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155132468 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [4-[2-(3-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Sc2ccc3nn(-c4cc(C)cc(CCCC)c4O)nc3c2)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-5-6-7-19-14-18(4)15-25(26(19)31)30-28-23-13-12-22(16-24(23)29-30)34-21-10-8-20(9-11-21)33-27(32)17(2)3/h8-16,31H,2,5-7H2,1,3-4H3 |
| InChIKey | LMOFXRHQDGUBRK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|