C19H30FN5O — CID 155132694
4-[4-[3-[(dimethylamino)methyl]-5-fluorophenoxy]piperidin-1-yl]-3-(2-methylhydrazinyl)butanenitrile (PubChem CID 155132694) has the molecular formula C19H30FN5O and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-[4-[3-[(dimethylamino)methyl]-5-fluorophenoxy]piperidin-1-yl]-3-(2-methylhydrazinyl)butanenitrile.
| Compound Name | 4-[4-[3-[(dimethylamino)methyl]-5-fluorophenoxy]piperidin-1-yl]-3-(2-methylhydrazinyl)butanenitrile |
|---|---|
| PubChem CID | 155132694 |
| Molecular Formula | C19H30FN5O |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[4-[3-[(dimethylamino)methyl]-5-fluorophenoxy]piperidin-1-yl]-3-(2-methylhydrazinyl)butanenitrile |
| SMILES | CNNC(CC#N)CN1CCC(Oc2cc(F)cc(CN(C)C)c2)CC1 |
| InChI | InChI=1S/C19H30FN5O/c1-22-23-17(4-7-21)14-25-8-5-18(6-9-25)26-19-11-15(13-24(2)3)10-16(20)12-19/h10-12,17-18,22-23H,4-6,8-9,13-14H2,1-3H3 |
| InChIKey | MVHZUTUCUDHQNB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|