C10H11F2NO — CID 166708869
3-cyclopropyloxy-2,5-difluoro-N-methylaniline (PubChem CID 166708869) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 3-cyclopropyloxy-2,5-difluoro-N-methylaniline.
| Compound Name | 3-cyclopropyloxy-2,5-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 166708869 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-cyclopropyloxy-2,5-difluoro-N-methylaniline |
| SMILES | CNc1cc(F)cc(OC2CC2)c1F |
| InChI | InChI=1S/C10H11F2NO/c1-13-8-4-6(11)5-9(10(8)12)14-7-2-3-7/h4-5,7,13H,2-3H2,1H3 |
| InChIKey | PBXXTXRRKJVZNR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |