C19H30ClNO3 — CID 155134956
tert-butyl N-[(6R)-6-(2-chlorophenyl)-6-hydroxy-2-methylhexan-2-yl]-N-methylcarbamate (PubChem CID 155134956) has the molecular formula C19H30ClNO3 and a molecular weight of 355.91 g/mol. Its IUPAC name is tert-butyl N-[(6R)-6-(2-chlorophenyl)-6-hydroxy-2-methylhexan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(6R)-6-(2-chlorophenyl)-6-hydroxy-2-methylhexan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155134956 |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl N-[(6R)-6-(2-chlorophenyl)-6-hydroxy-2-methylhexan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(C)(C)CCC[C@@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C19H30ClNO3/c1-18(2,3)24-17(23)21(6)19(4,5)13-9-12-16(22)14-10-7-8-11-15(14)20/h7-8,10-11,16,22H,9,12-13H2,1-6H3/t16-/m1/s1 |
| InChIKey | XUKPBCCKUZCACS-MRXNPFEDSA-N |
| XLogP | 5.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |