C15H18Cl3NO4 — CID 165440928
chloromethyl 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate (PubChem CID 165440928) has the molecular formula C15H18Cl3NO4 and a molecular weight of 382.67 g/mol. Its IUPAC name is chloromethyl 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate.
| Compound Name | chloromethyl 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
|---|---|
| PubChem CID | 165440928 |
| Molecular Formula | C15H18Cl3NO4 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | chloromethyl 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
| SMILES | CN(C(=O)OC(C)(C)C)C(C(=O)OCCl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H18Cl3NO4/c1-15(2,3)23-14(21)19(4)12(13(20)22-8-16)9-6-5-7-10(17)11(9)18/h5-7,12H,8H2,1-4H3 |
| InChIKey | BXDMMJIDPWEMAC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|