C30H52N6O2 — CID 155136296
6-[4-[3-(3-methoxy-2,2-dimethylbutoxy)-2,2-dimethylpropyl]piperazin-1-yl]-4-N-pentylquinoline-2,3,4-triamine (PubChem CID 155136296) has the molecular formula C30H52N6O2 and a molecular weight of 528.79 g/mol. Its IUPAC name is 6-[4-[3-(3-methoxy-2,2-dimethylbutoxy)-2,2-dimethylpropyl]piperazin-1-yl]-4-N-pentylquinoline-2,3,4-triamine.
| Compound Name | 6-[4-[3-(3-methoxy-2,2-dimethylbutoxy)-2,2-dimethylpropyl]piperazin-1-yl]-4-N-pentylquinoline-2,3,4-triamine |
|---|---|
| PubChem CID | 155136296 |
| Molecular Formula | C30H52N6O2 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | 6-[4-[3-(3-methoxy-2,2-dimethylbutoxy)-2,2-dimethylpropyl]piperazin-1-yl]-4-N-pentylquinoline-2,3,4-triamine |
| SMILES | CCCCCNc1c(N)c(N)nc2ccc(N3CCN(CC(C)(C)COCC(C)(C)C(C)OC)CC3)cc12 |
| InChI | InChI=1S/C30H52N6O2/c1-8-9-10-13-33-27-24-18-23(11-12-25(24)34-28(32)26(27)31)36-16-14-35(15-17-36)19-29(3,4)20-38-21-30(5,6)22(2)37-7/h11-12,18,22H,8-10,13-17,19-21,31H2,1-7H3,(H3,32,33,34) |
| InChIKey | RBNPJIQRCKWEFP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|