C32H51N6O3PS — CID 155696750
tert-butyl 2-[3-[4-(4-amino-1,2-dibutylimidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]-2-methyl-2-sulfanylpropoxy]phosphanylacetate (PubChem CID 155696750) has the molecular formula C32H51N6O3PS and a molecular weight of 630.84 g/mol. Its IUPAC name is tert-butyl 2-[3-[4-(4-amino-1,2-dibutylimidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]-2-methyl-2-sulfanylpropoxy]phosphanylacetate.
| Compound Name | tert-butyl 2-[3-[4-(4-amino-1,2-dibutylimidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]-2-methyl-2-sulfanylpropoxy]phosphanylacetate |
|---|---|
| PubChem CID | 155696750 |
| Molecular Formula | C32H51N6O3PS |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | tert-butyl 2-[3-[4-(4-amino-1,2-dibutylimidazo[4,5-c]quinolin-8-yl)piperazin-1-yl]-2-methyl-2-sulfanylpropoxy]phosphanylacetate |
| SMILES | CCCCc1nc2c(N)nc3ccc(N4CCN(CC(C)(S)COPCC(=O)OC(C)(C)C)CC4)cc3c2n1CCCC |
| InChI | InChI=1S/C32H51N6O3PS/c1-7-9-11-26-35-28-29(38(26)14-10-8-2)24-19-23(12-13-25(24)34-30(28)33)37-17-15-36(16-18-37)21-32(6,43)22-40-42-20-27(39)41-31(3,4)5/h12-13,19,42-43H,7-11,14-18,20-22H2,1-6H3,(H2,33,34) |
| InChIKey | WSJHGBFENZHJDL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|