C34H57N7OS — CID 155696696
1-[4-[4-amino-2-butyl-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-8-yl]piperazin-1-yl]-2-(2,4-dimethylpentan-2-yloxy)propane-2-thiol (PubChem CID 155696696) has the molecular formula C34H57N7OS and a molecular weight of 611.95 g/mol. Its IUPAC name is 1-[4-[4-amino-2-butyl-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-8-yl]piperazin-1-yl]-2-(2,4-dimethylpentan-2-yloxy)propane-2-thiol.
| Compound Name | 1-[4-[4-amino-2-butyl-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-8-yl]piperazin-1-yl]-2-(2,4-dimethylpentan-2-yloxy)propane-2-thiol |
|---|---|
| PubChem CID | 155696696 |
| Molecular Formula | C34H57N7OS |
| Molecular Weight | 611.95 g/mol |
| Exact Mass | 611.43 |
| IUPAC Name | 1-[4-[4-amino-2-butyl-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-8-yl]piperazin-1-yl]-2-(2,4-dimethylpentan-2-yloxy)propane-2-thiol |
| SMILES | CCCCc1nc2c(N)nc3ccc(N4CCN(CC(C)(S)OC(C)(C)CC(C)C)CC4)cc3c2n1CCCCN(C)C |
| InChI | InChI=1S/C34H57N7OS/c1-9-10-13-29-37-30-31(41(29)17-12-11-16-38(7)8)27-22-26(14-15-28(27)36-32(30)35)40-20-18-39(19-21-40)24-34(6,43)42-33(4,5)23-25(2)3/h14-15,22,25,43H,9-13,16-21,23-24H2,1-8H3,(H2,35,36) |
| InChIKey | QTBVEPWVBLRDBU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.95 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|