C28H41N7O — CID 169260510
2-butyl-8-(4-methylpiperazin-1-yl)-1-[(E)-4-(oxan-4-ylamino)but-2-enyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 169260510) has the molecular formula C28H41N7O and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-butyl-8-(4-methylpiperazin-1-yl)-1-[(E)-4-(oxan-4-ylamino)but-2-enyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-8-(4-methylpiperazin-1-yl)-1-[(E)-4-(oxan-4-ylamino)but-2-enyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 169260510 |
| Molecular Formula | C28H41N7O |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 2-butyl-8-(4-methylpiperazin-1-yl)-1-[(E)-4-(oxan-4-ylamino)but-2-enyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccc(N4CCN(C)CC4)cc3c2n1C/C=C/CNC1CCOCC1 |
| InChI | InChI=1S/C28H41N7O/c1-3-4-7-25-32-26-27(35(25)13-6-5-12-30-21-10-18-36-19-11-21)23-20-22(8-9-24(23)31-28(26)29)34-16-14-33(2)15-17-34/h5-6,8-9,20-21,30H,3-4,7,10-19H2,1-2H3,(H2,29,31)/b6-5+ |
| InChIKey | DLHBLAOUGKLDQN-AATRIKPKSA-N |
| XLogP | 3.59 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|