C22H25NO8 — CID 155141114
methyl 2-[4-acetyl-2-[(5-acetyl-2-hydroxy-3-methoxyanilino)methyl]-6-methoxyphenoxy]acetate (PubChem CID 155141114) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is methyl 2-[4-acetyl-2-[(5-acetyl-2-hydroxy-3-methoxyanilino)methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-acetyl-2-[(5-acetyl-2-hydroxy-3-methoxyanilino)methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 155141114 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | methyl 2-[4-acetyl-2-[(5-acetyl-2-hydroxy-3-methoxyanilino)methyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(CNc2cc(C(C)=O)cc(OC)c2O)cc(C(C)=O)cc1OC |
| InChI | InChI=1S/C22H25NO8/c1-12(24)14-6-16(22(19(9-14)29-4)31-11-20(26)30-5)10-23-17-7-15(13(2)25)8-18(28-3)21(17)27/h6-9,23,27H,10-11H2,1-5H3 |
| InChIKey | FHCIZKDSOPUWFK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|