C23H29NO6S2 — CID 155141165
1-[3-[(5-acetyl-2-ethylsulfanyloxy-3-methoxyanilino)methyl]-4-ethylsulfanyloxy-5-methoxyphenyl]ethanone (PubChem CID 155141165) has the molecular formula C23H29NO6S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 1-[3-[(5-acetyl-2-ethylsulfanyloxy-3-methoxyanilino)methyl]-4-ethylsulfanyloxy-5-methoxyphenyl]ethanone.
| Compound Name | 1-[3-[(5-acetyl-2-ethylsulfanyloxy-3-methoxyanilino)methyl]-4-ethylsulfanyloxy-5-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 155141165 |
| Molecular Formula | C23H29NO6S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-[3-[(5-acetyl-2-ethylsulfanyloxy-3-methoxyanilino)methyl]-4-ethylsulfanyloxy-5-methoxyphenyl]ethanone |
| SMILES | CCSOc1c(CNc2cc(C(C)=O)cc(OC)c2OSCC)cc(C(C)=O)cc1OC |
| InChI | InChI=1S/C23H29NO6S2/c1-7-31-29-22-18(9-16(14(3)25)11-20(22)27-5)13-24-19-10-17(15(4)26)12-21(28-6)23(19)30-32-8-2/h9-12,24H,7-8,13H2,1-6H3 |
| InChIKey | RJIZBCQKKFXWEL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|